C8H9NO2 — CID 69444426
1,2,4a,8a-tetrahydro-3,1-benzoxazin-4-one (PubChem CID 69444426) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 1,2,4a,8a-tetrahydro-3,1-benzoxazin-4-one.
| Compound Name | 1,2,4a,8a-tetrahydro-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 69444426 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 1,2,4a,8a-tetrahydro-3,1-benzoxazin-4-one |
| SMILES | O=C1OCNC2C=CC=CC12 |
| InChI | InChI=1S/C8H9NO2/c10-8-6-3-1-2-4-7(6)9-5-11-8/h1-4,6-7,9H,5H2 |
| InChIKey | ZFMXTPPEZHQQDG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |