C22H27NO2 — CID 69444578
2-[(3S,4R)-1-(aminomethyl)-3,4-dibenzylcyclopentyl]acetic acid (PubChem CID 69444578) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-[(3S,4R)-1-(aminomethyl)-3,4-dibenzylcyclopentyl]acetic acid.
| Compound Name | 2-[(3S,4R)-1-(aminomethyl)-3,4-dibenzylcyclopentyl]acetic acid |
|---|---|
| PubChem CID | 69444578 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-[(3S,4R)-1-(aminomethyl)-3,4-dibenzylcyclopentyl]acetic acid |
| SMILES | NCC1(CC(=O)O)C[C@@H](Cc2ccccc2)[C@@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H27NO2/c23-16-22(15-21(24)25)13-19(11-17-7-3-1-4-8-17)20(14-22)12-18-9-5-2-6-10-18/h1-10,19-20H,11-16,23H2,(H,24,25)/t19-,20+,22? |
| InChIKey | HBFZWKRCDVWGSA-RLAPIPATSA-N |
| XLogP | 3.92 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |