About ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate
ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate (PubChem CID 69444644) has the molecular formula C16H25N3O2
and a molecular weight of 291.39 g/mol. Its IUPAC name is ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate |
| PubChem CID | 69444644 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate |
| SMILES | CCCN(CCC)c1nc(C(=O)OCC)nc2c1CCC2 |
| InChI | InChI=1S/C16H25N3O2/c1-4-10-19(11-5-2)15-12-8-7-9-13(12)17-14(18-15)16(20)21-6-3/h4-11H2,1-3H3 |
| InChIKey | SHROPHWDIUBNBS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate?
The IUPAC name of ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate (CID 69444644) is ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate.
What is the SMILES notation for ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate?
The canonical SMILES for ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate is CCCN(CCC)c1nc(C(=O)OCC)nc2c1CCC2.
What is the InChIKey of ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate?
The InChIKey is SHROPHWDIUBNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-4-10-19(11-5-2)15-12-8-7-9-13(12)17-14(18-15)16(20)21-6-3/h4-11H2,1-3H3.
What are the key properties of ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate?
ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate has a molecular weight of 291.39 g/mol, XLogP of 2.77, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(dipropylamino)-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate is sourced from PubChem (CID 69444644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).