About 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane
2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane (PubChem CID 69444864) has the molecular formula C10H17BrClNO3S
and a molecular weight of 346.67 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane.
Molecular Properties
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane |
| PubChem CID | 69444864 |
| Molecular Formula | C10H17BrClNO3S |
| Molecular Weight | 346.67 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane |
| SMILES | Clc1ccc(Br)cc1.NC(CO)(CO)CO.S |
| InChI | InChI=1S/C6H4BrCl.C4H11NO3.H2S/c7-5-1-3-6(8)4-2-5;5-4(1-6,2-7)3-8;/h1-4H;6-8H,1-3,5H2;1H2 |
| InChIKey | DIJSRKGJEKOXAV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.67 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane?
The IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane (CID 69444864) is 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane.
What is the SMILES notation for 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane?
The canonical SMILES for 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane is Clc1ccc(Br)cc1.NC(CO)(CO)CO.S.
What is the InChIKey of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane?
The InChIKey is DIJSRKGJEKOXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrCl.C4H11NO3.H2S/c7-5-1-3-6(8)4-2-5;5-4(1-6,2-7)3-8;/h1-4H;6-8H,1-3,5H2;1H2.
What are the key properties of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane?
2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane has a molecular weight of 346.67 g/mol, XLogP of 0.88, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(hydroxymethyl)propane-1,3-diol;1-bromo-4-chlorobenzene;sulfane is sourced from PubChem (CID 69444864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).