C22H29N3O3 — CID 69445707
5-cycloheptyl-1-(2-cyclopentyl-2-oxoethyl)-1,3,5-benzotriazepine-2,4-dione (PubChem CID 69445707) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 5-cycloheptyl-1-(2-cyclopentyl-2-oxoethyl)-1,3,5-benzotriazepine-2,4-dione.
| Compound Name | 5-cycloheptyl-1-(2-cyclopentyl-2-oxoethyl)-1,3,5-benzotriazepine-2,4-dione |
|---|---|
| PubChem CID | 69445707 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 5-cycloheptyl-1-(2-cyclopentyl-2-oxoethyl)-1,3,5-benzotriazepine-2,4-dione |
| SMILES | O=C(CN1C(=O)NC(=O)N(C2CCCCCC2)c2ccccc21)C1CCCC1 |
| InChI | InChI=1S/C22H29N3O3/c26-20(16-9-5-6-10-16)15-24-18-13-7-8-14-19(18)25(22(28)23-21(24)27)17-11-3-1-2-4-12-17/h7-8,13-14,16-17H,1-6,9-12,15H2,(H,23,27,28) |
| InChIKey | WISICRYHENXXOQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |