C8H16Cl3N — CID 69446979
1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride (PubChem CID 69446979) has the molecular formula C8H16Cl3N and a molecular weight of 232.58 g/mol. Its IUPAC name is 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride.
| Compound Name | 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 69446979 |
| Molecular Formula | C8H16Cl3N |
| Molecular Weight | 232.58 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride |
| SMILES | Cl.ClCCC1CCN(CCCl)C1 |
| InChI | InChI=1S/C8H15Cl2N.ClH/c9-3-1-8-2-5-11(7-8)6-4-10;/h8H,1-7H2;1H |
| InChIKey | APGJTPRNQZOGQS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|