About 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride
1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride (PubChem CID 69446979) has the molecular formula C8H16Cl3N
and a molecular weight of 232.58 g/mol. Its IUPAC name is 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride |
| PubChem CID | 69446979 |
| Molecular Formula | C8H16Cl3N |
| Molecular Weight | 232.58 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride |
| SMILES | Cl.ClCCC1CCN(CCCl)C1 |
| InChI | InChI=1S/C8H15Cl2N.ClH/c9-3-1-8-2-5-11(7-8)6-4-10;/h8H,1-7H2;1H |
| InChIKey | APGJTPRNQZOGQS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride?
The IUPAC name of 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride (CID 69446979) is 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride.
What is the SMILES notation for 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride?
The canonical SMILES for 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride is Cl.ClCCC1CCN(CCCl)C1.
What is the InChIKey of 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride?
The InChIKey is APGJTPRNQZOGQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15Cl2N.ClH/c9-3-1-8-2-5-11(7-8)6-4-10;/h8H,1-7H2;1H.
What are the key properties of 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride?
1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride has a molecular weight of 232.58 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2-chloroethyl)pyrrolidine;hydrochloride is sourced from PubChem (CID 69446979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).