About 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole
3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole (PubChem CID 69447019) has the molecular formula C21H22ClFN2
and a molecular weight of 356.87 g/mol. Its IUPAC name is 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole |
| PubChem CID | 69447019 |
| Molecular Formula | C21H22ClFN2 |
| Molecular Weight | 356.87 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole |
| SMILES | Fc1ccc2c(c1)C(C1CCN(C/C=C/c3ccc(Cl)cc3)C1)CN2 |
| InChI | InChI=1S/C21H22ClFN2/c22-17-5-3-15(4-6-17)2-1-10-25-11-9-16(14-25)20-13-24-21-8-7-18(23)12-19(20)21/h1-8,12,16,20,24H,9-11,13-14H2/b2-1+ |
| InChIKey | NSBHNOSXBQVAFU-OWOJBTEDSA-N |
| XLogP | 5.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole?
The IUPAC name of 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole (CID 69447019) is 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole.
What is the SMILES notation for 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole?
The canonical SMILES for 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole is Fc1ccc2c(c1)C(C1CCN(C/C=C/c3ccc(Cl)cc3)C1)CN2.
What is the InChIKey of 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole?
The InChIKey is NSBHNOSXBQVAFU-OWOJBTEDSA-N. The full InChI is InChI=1S/C21H22ClFN2/c22-17-5-3-15(4-6-17)2-1-10-25-11-9-16(14-25)20-13-24-21-8-7-18(23)12-19(20)21/h1-8,12,16,20,24H,9-11,13-14H2/b2-1+.
What are the key properties of 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole?
3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole has a molecular weight of 356.87 g/mol, XLogP of 5.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(E)-3-(4-chlorophenyl)prop-2-enyl]pyrrolidin-3-yl]-5-fluoro-2,3-dihydro-1H-indole is sourced from PubChem (CID 69447019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).