About 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine
3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine (PubChem CID 69447740) has the molecular formula C18H17BrFN3
and a molecular weight of 374.26 g/mol. Its IUPAC name is 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine.
Molecular Properties
| Compound Name | 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine |
| PubChem CID | 69447740 |
| Molecular Formula | C18H17BrFN3 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine |
| SMILES | Fc1ccc(-c2nn3c(NC4CCCC4)cccc3c2Br)cc1 |
| InChI | InChI=1S/C18H17BrFN3/c19-17-15-6-3-7-16(21-14-4-1-2-5-14)23(15)22-18(17)12-8-10-13(20)11-9-12/h3,6-11,14,21H,1-2,4-5H2 |
| InChIKey | JPCHUGJACCMNKC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine?
The IUPAC name of 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine (CID 69447740) is 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine.
What is the SMILES notation for 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine?
The canonical SMILES for 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine is Fc1ccc(-c2nn3c(NC4CCCC4)cccc3c2Br)cc1.
What is the InChIKey of 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine?
The InChIKey is JPCHUGJACCMNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrFN3/c19-17-15-6-3-7-16(21-14-4-1-2-5-14)23(15)22-18(17)12-8-10-13(20)11-9-12/h3,6-11,14,21H,1-2,4-5H2.
What are the key properties of 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine?
3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine has a molecular weight of 374.26 g/mol, XLogP of 5.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-cyclopentyl-2-(4-fluorophenyl)pyrazolo[1,5-a]pyridin-7-amine is sourced from PubChem (CID 69447740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).