About 2-hepta-1,6-dien-4-yl-1H-imidazole
2-hepta-1,6-dien-4-yl-1H-imidazole (PubChem CID 69448654) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-hepta-1,6-dien-4-yl-1H-imidazole.
Molecular Properties
| Compound Name | 2-hepta-1,6-dien-4-yl-1H-imidazole |
| PubChem CID | 69448654 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-hepta-1,6-dien-4-yl-1H-imidazole |
| SMILES | C=CCC(CC=C)c1ncc[nH]1 |
| InChI | InChI=1S/C10H14N2/c1-3-5-9(6-4-2)10-11-7-8-12-10/h3-4,7-9H,1-2,5-6H2,(H,11,12) |
| InChIKey | WNEKLTGPHSYQMU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hepta-1,6-dien-4-yl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hepta-1,6-dien-4-yl-1H-imidazole?
The IUPAC name of 2-hepta-1,6-dien-4-yl-1H-imidazole (CID 69448654) is 2-hepta-1,6-dien-4-yl-1H-imidazole.
What is the SMILES notation for 2-hepta-1,6-dien-4-yl-1H-imidazole?
The canonical SMILES for 2-hepta-1,6-dien-4-yl-1H-imidazole is C=CCC(CC=C)c1ncc[nH]1.
What is the InChIKey of 2-hepta-1,6-dien-4-yl-1H-imidazole?
The InChIKey is WNEKLTGPHSYQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-3-5-9(6-4-2)10-11-7-8-12-10/h3-4,7-9H,1-2,5-6H2,(H,11,12).
What are the key properties of 2-hepta-1,6-dien-4-yl-1H-imidazole?
2-hepta-1,6-dien-4-yl-1H-imidazole has a molecular weight of 162.24 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hepta-1,6-dien-4-yl-1H-imidazole is sourced from PubChem (CID 69448654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).