About 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione
3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione (PubChem CID 69449764) has the molecular formula C17H20BrNO2
and a molecular weight of 350.26 g/mol. Its IUPAC name is 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione |
| PubChem CID | 69449764 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione |
| SMILES | CCc1cc(C)cc(Br)c1C1C(=O)NC(C)(C2CC2)C1=O |
| InChI | InChI=1S/C17H20BrNO2/c1-4-10-7-9(2)8-12(18)13(10)14-15(20)17(3,11-5-6-11)19-16(14)21/h7-8,11,14H,4-6H2,1-3H3,(H,19,21) |
| InChIKey | CSGGPFBLGGNZCJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione?
The IUPAC name of 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione (CID 69449764) is 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione.
What is the SMILES notation for 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione?
The canonical SMILES for 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione is CCc1cc(C)cc(Br)c1C1C(=O)NC(C)(C2CC2)C1=O.
What is the InChIKey of 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione?
The InChIKey is CSGGPFBLGGNZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20BrNO2/c1-4-10-7-9(2)8-12(18)13(10)14-15(20)17(3,11-5-6-11)19-16(14)21/h7-8,11,14H,4-6H2,1-3H3,(H,19,21).
What are the key properties of 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione?
3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione has a molecular weight of 350.26 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromo-6-ethyl-4-methylphenyl)-5-cyclopropyl-5-methylpyrrolidine-2,4-dione is sourced from PubChem (CID 69449764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).