About 1,6-dihydropyrrolo[2,3-f]indole
1,6-dihydropyrrolo[2,3-f]indole (PubChem CID 69450160) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 1,6-dihydropyrrolo[2,3-f]indole.
Molecular Properties
| Compound Name | 1,6-dihydropyrrolo[2,3-f]indole |
| PubChem CID | 69450160 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 1,6-dihydropyrrolo[2,3-f]indole |
| SMILES | C1=c2cc3[nH]ccc3cc2=NC1 |
| InChI | InChI=1S/C10H8N2/c1-3-11-9-6-8-2-4-12-10(8)5-7(1)9/h1-3,5-6,11H,4H2 |
| InChIKey | RSFQDMZJBWLZJJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-dihydropyrrolo[2,3-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrrolo[2,3-f]indole?
The IUPAC name of 1,6-dihydropyrrolo[2,3-f]indole (CID 69450160) is 1,6-dihydropyrrolo[2,3-f]indole.
What is the SMILES notation for 1,6-dihydropyrrolo[2,3-f]indole?
The canonical SMILES for 1,6-dihydropyrrolo[2,3-f]indole is C1=c2cc3[nH]ccc3cc2=NC1.
What is the InChIKey of 1,6-dihydropyrrolo[2,3-f]indole?
The InChIKey is RSFQDMZJBWLZJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2/c1-3-11-9-6-8-2-4-12-10(8)5-7(1)9/h1-3,5-6,11H,4H2.
What are the key properties of 1,6-dihydropyrrolo[2,3-f]indole?
1,6-dihydropyrrolo[2,3-f]indole has a molecular weight of 156.19 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrrolo[2,3-f]indole is sourced from PubChem (CID 69450160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).