C25H26F2N6O3 — CID 69450180
N-(3,5-difluoro-2-pyridinyl)-4-[4-[(2-methoxy-3-methylphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide (PubChem CID 69450180) has the molecular formula C25H26F2N6O3 and a molecular weight of 496.52 g/mol. Its IUPAC name is N-(3,5-difluoro-2-pyridinyl)-4-[4-[(2-methoxy-3-methylphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide.
| Compound Name | N-(3,5-difluoro-2-pyridinyl)-4-[4-[(2-methoxy-3-methylphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 69450180 |
| Molecular Formula | C25H26F2N6O3 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-(3,5-difluoro-2-pyridinyl)-4-[4-[(2-methoxy-3-methylphenyl)carbamoylamino]phenyl]piperazine-1-carboxamide |
| SMILES | COc1c(C)cccc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3ncc(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C25H26F2N6O3/c1-16-4-3-5-21(22(16)36-2)30-24(34)29-18-6-8-19(9-7-18)32-10-12-33(13-11-32)25(35)31-23-20(27)14-17(26)15-28-23/h3-9,14-15H,10-13H2,1-2H3,(H,28,31,35)(H2,29,30,34) |
| InChIKey | OLZZKBPGXUNJOW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|