C26H28ClN5O3 — CID 69450352
4-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-N-(2-methylphenyl)piperazine-1-carboxamide (PubChem CID 69450352) has the molecular formula C26H28ClN5O3 and a molecular weight of 494.00 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-N-(2-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-N-(2-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 69450352 |
| Molecular Formula | C26H28ClN5O3 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 4-[4-[(5-chloro-2-methoxyphenyl)carbamoylamino]phenyl]-N-(2-methylphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)Nc1ccc(N2CCN(C(=O)Nc3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C26H28ClN5O3/c1-18-5-3-4-6-22(18)30-26(34)32-15-13-31(14-16-32)21-10-8-20(9-11-21)28-25(33)29-23-17-19(27)7-12-24(23)35-2/h3-12,17H,13-16H2,1-2H3,(H,30,34)(H2,28,29,33) |
| InChIKey | UVVMIGSZZCMSAW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|