C9H22O5Si2 — CID 69450469
2,3,6,6-tetramethoxy-2,3-dimethyloxadisilinane (PubChem CID 69450469) has the molecular formula C9H22O5Si2 and a molecular weight of 266.44 g/mol. Its IUPAC name is 2,3,6,6-tetramethoxy-2,3-dimethyloxadisilinane.
| Compound Name | 2,3,6,6-tetramethoxy-2,3-dimethyloxadisilinane |
|---|---|
| PubChem CID | 69450469 |
| Molecular Formula | C9H22O5Si2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2,3,6,6-tetramethoxy-2,3-dimethyloxadisilinane |
| SMILES | COC1(OC)CC[Si](C)(OC)[Si](C)(OC)O1 |
| InChI | InChI=1S/C9H22O5Si2/c1-10-9(11-2)7-8-15(5,12-3)16(6,13-4)14-9/h7-8H2,1-6H3 |
| InChIKey | BNAGDOKLSSQWSV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|