About 7-pentyl-1H-pteridine-2,4-dione
7-pentyl-1H-pteridine-2,4-dione (PubChem CID 69450647) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is 7-pentyl-1H-pteridine-2,4-dione.
Molecular Properties
| Compound Name | 7-pentyl-1H-pteridine-2,4-dione |
| PubChem CID | 69450647 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 7-pentyl-1H-pteridine-2,4-dione |
| SMILES | CCCCCc1cnc2c(=O)[nH]c(=O)[nH]c2n1 |
| InChI | InChI=1S/C11H14N4O2/c1-2-3-4-5-7-6-12-8-9(13-7)14-11(17)15-10(8)16/h6H,2-5H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | NHJFFCPOABPDFZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-pentyl-1H-pteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pentyl-1H-pteridine-2,4-dione?
The IUPAC name of 7-pentyl-1H-pteridine-2,4-dione (CID 69450647) is 7-pentyl-1H-pteridine-2,4-dione.
What is the SMILES notation for 7-pentyl-1H-pteridine-2,4-dione?
The canonical SMILES for 7-pentyl-1H-pteridine-2,4-dione is CCCCCc1cnc2c(=O)[nH]c(=O)[nH]c2n1.
What is the InChIKey of 7-pentyl-1H-pteridine-2,4-dione?
The InChIKey is NHJFFCPOABPDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c1-2-3-4-5-7-6-12-8-9(13-7)14-11(17)15-10(8)16/h6H,2-5H2,1H3,(H2,13,14,15,16,17).
What are the key properties of 7-pentyl-1H-pteridine-2,4-dione?
7-pentyl-1H-pteridine-2,4-dione has a molecular weight of 234.26 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pentyl-1H-pteridine-2,4-dione is sourced from PubChem (CID 69450647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).