C16H20NO4- — CID 6945106
cis-(1S,2R)-2-[(2-methoxyphenyl)methylcarbamoyl]cyclohexane-1-carboxylate (PubChem CID 6945106) has the molecular formula C16H20NO4- and a molecular weight of 290.34 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(2-methoxyphenyl)methylcarbamoyl]cyclohexane-1-carboxylate.
| Compound Name | cis-(1S,2R)-2-[(2-methoxyphenyl)methylcarbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6945106 |
| Molecular Formula | C16H20NO4- |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | cis-(1S,2R)-2-[(2-methoxyphenyl)methylcarbamoyl]cyclohexane-1-carboxylate |
| SMILES | COc1ccccc1CNC(=O)[C@@H]1CCCC[C@@H]1C(=O)[O-] |
| InChI | InChI=1S/C16H21NO4/c1-21-14-9-5-2-6-11(14)10-17-15(18)12-7-3-4-8-13(12)16(19)20/h2,5-6,9,12-13H,3-4,7-8,10H2,1H3,(H,17,18)(H,19,20)/p-1/t12-,13+/m1/s1 |
| InChIKey | IJVLENARSSQFSI-OLZOCXBDSA-M |
| XLogP | 0.87 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |