About 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide
2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide (PubChem CID 69452268) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide.
Molecular Properties
| Compound Name | 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide |
| PubChem CID | 69452268 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide |
| SMILES | C=C(C(N)=O)C1(O)C=CC=C(O)C1 |
| InChI | InChI=1S/C9H11NO3/c1-6(8(10)12)9(13)4-2-3-7(11)5-9/h2-4,11,13H,1,5H2,(H2,10,12) |
| InChIKey | ZTUFPVAFNLJTOB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide?
The IUPAC name of 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide (CID 69452268) is 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide.
What is the SMILES notation for 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide?
The canonical SMILES for 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide is C=C(C(N)=O)C1(O)C=CC=C(O)C1.
What is the InChIKey of 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide?
The InChIKey is ZTUFPVAFNLJTOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-6(8(10)12)9(13)4-2-3-7(11)5-9/h2-4,11,13H,1,5H2,(H2,10,12).
What are the key properties of 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide?
2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide has a molecular weight of 181.19 g/mol, XLogP of 0.16, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dihydroxycyclohexa-2,4-dien-1-yl)prop-2-enamide is sourced from PubChem (CID 69452268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).