C27H35N3O2S — CID 69452466
3-cyclopentyl-7-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 69452466) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is 3-cyclopentyl-7-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-cyclopentyl-7-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 69452466 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 3-cyclopentyl-7-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCN(c2ccc3c(c2)CCN(C2CCCC2)CC3)CC1 |
| InChI | InChI=1S/C27H35N3O2S/c31-33(32,21-14-23-6-2-1-3-7-23)30-19-17-29(18-20-30)27-11-10-24-12-15-28(16-13-25(24)22-27)26-8-4-5-9-26/h1-3,6-7,10-11,14,21-22,26H,4-5,8-9,12-13,15-20H2/b21-14+ |
| InChIKey | WKZPAVKSYXKEGV-KGENOOAVSA-N |
| XLogP | 4.15 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|