C21H33ClN4O6 — CID 69452739
[3-amino-1-(4-chloro-N-[1-(4,4-diethoxybutan-2-ylamino)-1-oxopropan-2-yl]anilino)-1-oxopropan-2-yl]carbamic acid (PubChem CID 69452739) has the molecular formula C21H33ClN4O6 and a molecular weight of 472.97 g/mol. Its IUPAC name is [3-amino-1-(4-chloro-N-[1-(4,4-diethoxybutan-2-ylamino)-1-oxopropan-2-yl]anilino)-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [3-amino-1-(4-chloro-N-[1-(4,4-diethoxybutan-2-ylamino)-1-oxopropan-2-yl]anilino)-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 69452739 |
| Molecular Formula | C21H33ClN4O6 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | [3-amino-1-(4-chloro-N-[1-(4,4-diethoxybutan-2-ylamino)-1-oxopropan-2-yl]anilino)-1-oxopropan-2-yl]carbamic acid |
| SMILES | CCOC(CC(C)NC(=O)C(C)N(C(=O)C(CN)NC(=O)O)c1ccc(Cl)cc1)OCC |
| InChI | InChI=1S/C21H33ClN4O6/c1-5-31-18(32-6-2)11-13(3)24-19(27)14(4)26(16-9-7-15(22)8-10-16)20(28)17(12-23)25-21(29)30/h7-10,13-14,17-18,25H,5-6,11-12,23H2,1-4H3,(H,24,27)(H,29,30) |
| InChIKey | CXKCNJPUEFVYAJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 143.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|