C15H17F3OS — CID 69452976
1,1,1-trifluoro-2-[(4-methyl-2,3-dihydrothiochromen-4-yl)methyl]but-3-en-2-ol (PubChem CID 69452976) has the molecular formula C15H17F3OS and a molecular weight of 302.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[(4-methyl-2,3-dihydrothiochromen-4-yl)methyl]but-3-en-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[(4-methyl-2,3-dihydrothiochromen-4-yl)methyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 69452976 |
| Molecular Formula | C15H17F3OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1,1,1-trifluoro-2-[(4-methyl-2,3-dihydrothiochromen-4-yl)methyl]but-3-en-2-ol |
| SMILES | C=CC(O)(CC1(C)CCSc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C15H17F3OS/c1-3-14(19,15(16,17)18)10-13(2)8-9-20-12-7-5-4-6-11(12)13/h3-7,19H,1,8-10H2,2H3 |
| InChIKey | PIMDKRZQVLQECL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|