C7H6N4O3 — CID 69453099
1-ethenyl-7,9-dihydro-3H-purine-2,6,8-trione (PubChem CID 69453099) has the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. Its IUPAC name is 1-ethenyl-7,9-dihydro-3H-purine-2,6,8-trione.
| Compound Name | 1-ethenyl-7,9-dihydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 69453099 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 1-ethenyl-7,9-dihydro-3H-purine-2,6,8-trione |
| SMILES | C=Cn1c(=O)[nH]c2[nH]c(=O)[nH]c2c1=O |
| InChI | InChI=1S/C7H6N4O3/c1-2-11-5(12)3-4(10-7(11)14)9-6(13)8-3/h2H,1H2,(H,10,14)(H2,8,9,13) |
| InChIKey | BEYLLOLPRIODNG-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |