About 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate
5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate (PubChem CID 69453603) has the molecular formula C7H10O3S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate.
Molecular Properties
| Compound Name | 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate |
| PubChem CID | 69453603 |
| Molecular Formula | C7H10O3S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate |
| SMILES | O.O=S1(=O)CCCc2ccsc21 |
| InChI | InChI=1S/C7H8O2S2.H2O/c8-11(9)5-1-2-6-3-4-10-7(6)11;/h3-4H,1-2,5H2;1H2 |
| InChIKey | MQJNAPJDWROAQF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 65.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate?
The IUPAC name of 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate (CID 69453603) is 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate.
What is the SMILES notation for 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate?
The canonical SMILES for 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate is O.O=S1(=O)CCCc2ccsc21.
What is the InChIKey of 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate?
The InChIKey is MQJNAPJDWROAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S2.H2O/c8-11(9)5-1-2-6-3-4-10-7(6)11;/h3-4H,1-2,5H2;1H2.
What are the key properties of 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate?
5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate has a molecular weight of 206.29 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-thieno[2,3-b]thiopyran 7,7-dioxide;hydrate is sourced from PubChem (CID 69453603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).