C14H14F4O2 — CID 69454121
1,1,1-trifluoro-2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]but-3-en-2-ol (PubChem CID 69454121) has the molecular formula C14H14F4O2 and a molecular weight of 290.26 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]but-3-en-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 69454121 |
| Molecular Formula | C14H14F4O2 |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1,1,1-trifluoro-2-[(6-fluoro-3,4-dihydro-2H-chromen-4-yl)methyl]but-3-en-2-ol |
| SMILES | C=CC(O)(CC1CCOc2ccc(F)cc21)C(F)(F)F |
| InChI | InChI=1S/C14H14F4O2/c1-2-13(19,14(16,17)18)8-9-5-6-20-12-4-3-10(15)7-11(9)12/h2-4,7,9,19H,1,5-6,8H2 |
| InChIKey | AFQJOJJPHFVULT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|