C26H34O3 — CID 69454131
2,5,7,8-tetramethyl-2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-3,4-dihydrochromen-6-ol (PubChem CID 69454131) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 2,5,7,8-tetramethyl-2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-3,4-dihydrochromen-6-ol.
| Compound Name | 2,5,7,8-tetramethyl-2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 69454131 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2,5,7,8-tetramethyl-2-(2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-3,4-dihydrochromen-6-ol |
| SMILES | Cc1cc(C)c2c(c1C)OC(C)(C1(C)CCc3c(C)c(O)c(C)c(C)c3O1)CC2 |
| InChI | InChI=1S/C26H34O3/c1-14-13-15(2)20-9-11-25(7,28-23(20)16(14)3)26(8)12-10-21-19(6)22(27)17(4)18(5)24(21)29-26/h13,27H,9-12H2,1-8H3 |
| InChIKey | NUINROCIWDYVEB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |