C16H19F3O — CID 69454243
1,1,1-trifluoro-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]but-3-en-2-ol (PubChem CID 69454243) has the molecular formula C16H19F3O and a molecular weight of 284.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]but-3-en-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 69454243 |
| Molecular Formula | C16H19F3O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1,1,1-trifluoro-2-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]but-3-en-2-ol |
| SMILES | C=CC(O)(CC1CCC(C)c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C16H19F3O/c1-3-15(20,16(17,18)19)10-12-9-8-11(2)13-6-4-5-7-14(12)13/h3-7,11-12,20H,1,8-10H2,2H3 |
| InChIKey | XUMMAKGTKKOYIB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|