C26H37N5O5S — CID 69454522
N-[1-(1,3-benzoxazol-2-yl)-1-oxobutan-2-yl]-3-cyclohexyl-2-[[methanesulfonamido(pyrrolidin-1-yl)methylidene]amino]propanamide (PubChem CID 69454522) has the molecular formula C26H37N5O5S and a molecular weight of 531.68 g/mol. Its IUPAC name is N-[1-(1,3-benzoxazol-2-yl)-1-oxobutan-2-yl]-3-cyclohexyl-2-[[methanesulfonamido(pyrrolidin-1-yl)methylidene]amino]propanamide.
| Compound Name | N-[1-(1,3-benzoxazol-2-yl)-1-oxobutan-2-yl]-3-cyclohexyl-2-[[methanesulfonamido(pyrrolidin-1-yl)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 69454522 |
| Molecular Formula | C26H37N5O5S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N-[1-(1,3-benzoxazol-2-yl)-1-oxobutan-2-yl]-3-cyclohexyl-2-[[methanesulfonamido(pyrrolidin-1-yl)methylidene]amino]propanamide |
| SMILES | CCC(NC(=O)C(CC1CCCCC1)/N=C(\NS(C)(=O)=O)N1CCCC1)C(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C26H37N5O5S/c1-3-19(23(32)25-28-20-13-7-8-14-22(20)36-25)27-24(33)21(17-18-11-5-4-6-12-18)29-26(30-37(2,34)35)31-15-9-10-16-31/h7-8,13-14,18-19,21H,3-6,9-12,15-17H2,1-2H3,(H,27,33)(H,29,30) |
| InChIKey | MFMPAIPIPVXQOK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|