About 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid
2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid (PubChem CID 69454608) has the molecular formula C28H24F3N3O4
and a molecular weight of 523.51 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid |
| PubChem CID | 69454608 |
| Molecular Formula | C28H24F3N3O4 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)O)c1C.O=C(O)c1cccnc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15NO2.C13H9F3N2O2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h3-9,16H,1-2H3,(H,17,18);1-7H,(H,17,18)(H,19,20) |
| InChIKey | MRRFFMYLCLMCBW-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid?
The IUPAC name of 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid (CID 69454608) is 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid?
The canonical SMILES for 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid is Cc1cccc(Nc2ccccc2C(=O)O)c1C.O=C(O)c1cccnc1Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid?
The InChIKey is MRRFFMYLCLMCBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2.C13H9F3N2O2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h3-9,16H,1-2H3,(H,17,18);1-7H,(H,17,18)(H,19,20).
What are the key properties of 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid?
2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid has a molecular weight of 523.51 g/mol, XLogP of 7.29, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylanilino)benzoic acid;2-[3-(trifluoromethyl)anilino]pyridine-3-carboxylic acid is sourced from PubChem (CID 69454608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).