About 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one
7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 69455047) has the molecular formula C16H14O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| PubChem CID | 69455047 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(-c2ccc3c(c2)OCCC3=O)cc1 |
| InChI | InChI=1S/C16H14O3/c1-18-13-5-2-11(3-6-13)12-4-7-14-15(17)8-9-19-16(14)10-12/h2-7,10H,8-9H2,1H3 |
| InChIKey | MTTOMGYYUFKECO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one?
The IUPAC name of 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one (CID 69455047) is 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one.
What is the SMILES notation for 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one?
The canonical SMILES for 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one is COc1ccc(-c2ccc3c(c2)OCCC3=O)cc1.
What is the InChIKey of 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one?
The InChIKey is MTTOMGYYUFKECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c1-18-13-5-2-11(3-6-13)12-4-7-14-15(17)8-9-19-16(14)10-12/h2-7,10H,8-9H2,1H3.
What are the key properties of 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one?
7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one has a molecular weight of 254.29 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-methoxyphenyl)-2,3-dihydrochromen-4-one is sourced from PubChem (CID 69455047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).