About N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide
N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide (PubChem CID 69455106) has the molecular formula C16H13BrCl2F2N2O
and a molecular weight of 438.10 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide.
Molecular Properties
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide |
| PubChem CID | 69455106 |
| Molecular Formula | C16H13BrCl2F2N2O |
| Molecular Weight | 438.10 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide |
| SMILES | O=C(CCNCc1ccc(F)cc1F)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C16H13BrCl2F2N2O/c17-10-5-12(18)16(13(19)6-10)23-15(24)3-4-22-8-9-1-2-11(20)7-14(9)21/h1-2,5-7,22H,3-4,8H2,(H,23,24) |
| InChIKey | QHKOMLGPAINEIA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.10 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide?
The IUPAC name of N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide (CID 69455106) is N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide.
What is the SMILES notation for N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide?
The canonical SMILES for N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide is O=C(CCNCc1ccc(F)cc1F)Nc1c(Cl)cc(Br)cc1Cl.
What is the InChIKey of N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide?
The InChIKey is QHKOMLGPAINEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrCl2F2N2O/c17-10-5-12(18)16(13(19)6-10)23-15(24)3-4-22-8-9-1-2-11(20)7-14(9)21/h1-2,5-7,22H,3-4,8H2,(H,23,24).
What are the key properties of N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide?
N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide has a molecular weight of 438.10 g/mol, XLogP of 5.15, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,6-dichlorophenyl)-3-[(2,4-difluorophenyl)methylamino]propanamide is sourced from PubChem (CID 69455106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).