About 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid
4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid (PubChem CID 69456008) has the molecular formula C13H18FN3O5
and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid.
Molecular Properties
| Compound Name | 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid |
| PubChem CID | 69456008 |
| Molecular Formula | C13H18FN3O5 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid |
| SMILES | NCCC(Cn1c(=O)c(F)cn(C2CCCO2)c1=O)C(=O)O |
| InChI | InChI=1S/C13H18FN3O5/c14-9-7-16(10-2-1-5-22-10)13(21)17(11(9)18)6-8(3-4-15)12(19)20/h7-8,10H,1-6,15H2,(H,19,20) |
| InChIKey | UDRJBKDQZIKALU-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid?
The IUPAC name of 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid (CID 69456008) is 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid.
What is the SMILES notation for 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid?
The canonical SMILES for 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid is NCCC(Cn1c(=O)c(F)cn(C2CCCO2)c1=O)C(=O)O.
What is the InChIKey of 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid?
The InChIKey is UDRJBKDQZIKALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN3O5/c14-9-7-16(10-2-1-5-22-10)13(21)17(11(9)18)6-8(3-4-15)12(19)20/h7-8,10H,1-6,15H2,(H,19,20).
What are the key properties of 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid?
4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid has a molecular weight of 315.30 g/mol, XLogP of -0.49, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[[5-fluoro-2,6-dioxo-3-(oxolan-2-yl)pyrimidin-1-yl]methyl]butanoic acid is sourced from PubChem (CID 69456008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).