C25H22N7O+ — CID 69457264
(4R)-2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 69457264) has the molecular formula C25H22N7O+ and a molecular weight of 436.50 g/mol. Its IUPAC name is (4R)-2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | (4R)-2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 69457264 |
| Molecular Formula | C25H22N7O+ |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (4R)-2-(furan-2-yl)-6-[2-[1-(quinolin-3-ylmethyl)pyrrolidin-2-yl]ethynyl]-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | N[N@@+]12C=C(C#CC3CCCN3Cc3cnc4ccccc4c3)N=CC1=NC(c1ccco1)=N2 |
| InChI | InChI=1S/C25H22N7O/c26-32-17-20(27-15-24(32)29-25(30-32)23-8-4-12-33-23)9-10-21-6-3-11-31(21)16-18-13-19-5-1-2-7-22(19)28-14-18/h1-2,4-5,7-8,12-15,17,21H,3,6,11,16,26H2/q+1/t21?,32-/m1/s1 |
| InChIKey | RCYXYZSKIQATEU-XSPBBNBHSA-N |
| XLogP | 3.19 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|