About CID 69457343
CID 69457343 (PubChem CID 69457343) has the molecular formula C17H18ClN5NaO3S
and a molecular weight of 430.87 g/mol.
Molecular Properties
| Compound Name | CID 69457343 |
| PubChem CID | 69457343 |
| Molecular Formula | C17H18ClN5NaO3S |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | — |
| SMILES | COc1ccc2[nH]c(S(=O)Cc3nccc(N4CCOCC4)c3Cl)nc2n1.[Na] |
| InChI | InChI=1S/C17H18ClN5O3S.Na/c1-25-14-3-2-11-16(21-14)22-17(20-11)27(24)10-12-15(18)13(4-5-19-12)23-6-8-26-9-7-23;/h2-5H,6-10H2,1H3,(H,20,21,22); |
| InChIKey | MMOZMRQMESOOFS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 69457343 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69457343?
The IUPAC name of CID 69457343 (CID 69457343) is not available.
What is the SMILES notation for CID 69457343?
The canonical SMILES for CID 69457343 is COc1ccc2[nH]c(S(=O)Cc3nccc(N4CCOCC4)c3Cl)nc2n1.[Na].
What is the InChIKey of CID 69457343?
The InChIKey is MMOZMRQMESOOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN5O3S.Na/c1-25-14-3-2-11-16(21-14)22-17(20-11)27(24)10-12-15(18)13(4-5-19-12)23-6-8-26-9-7-23;/h2-5H,6-10H2,1H3,(H,20,21,22);.
What are the key properties of CID 69457343?
CID 69457343 has a molecular weight of 430.87 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69457343 is sourced from PubChem (CID 69457343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).