C30H36N6O4S — CID 69457896
1-(benzenesulfonyl)-1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)urea (PubChem CID 69457896) has the molecular formula C30H36N6O4S and a molecular weight of 576.72 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)urea.
| Compound Name | 1-(benzenesulfonyl)-1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)urea |
|---|---|
| PubChem CID | 69457896 |
| Molecular Formula | C30H36N6O4S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 1-(benzenesulfonyl)-1-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]butyl]-3-(1H-pyrrolo[2,3-b]pyridin-3-yl)urea |
| SMILES | CCOc1ccccc1N1CCN(CCCCN(C(=O)Nc2c[nH]c3ncccc23)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H36N6O4S/c1-2-40-28-15-7-6-14-27(28)35-21-19-34(20-22-35)17-8-9-18-36(41(38,39)24-11-4-3-5-12-24)30(37)33-26-23-32-29-25(26)13-10-16-31-29/h3-7,10-16,23H,2,8-9,17-22H2,1H3,(H,31,32)(H,33,37) |
| InChIKey | ILRCFTDHIPCSMV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|