C9H7BrF4O2 — CID 69458354
4-(bromomethyl)-2,3,5,6-tetrafluoro-1-methylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 69458354) has the molecular formula C9H7BrF4O2 and a molecular weight of 303.05 g/mol. Its IUPAC name is 4-(bromomethyl)-2,3,5,6-tetrafluoro-1-methylcyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-(bromomethyl)-2,3,5,6-tetrafluoro-1-methylcyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 69458354 |
| Molecular Formula | C9H7BrF4O2 |
| Molecular Weight | 303.05 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | 4-(bromomethyl)-2,3,5,6-tetrafluoro-1-methylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)C(F)=C(F)C(CBr)=C(F)C1F |
| InChI | InChI=1S/C9H7BrF4O2/c1-9(8(15)16)6(13)4(11)3(2-10)5(12)7(9)14/h6H,2H2,1H3,(H,15,16) |
| InChIKey | BTCDFRHUOVLRMH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.05 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|