C23H18N4O4S — CID 69458479
7-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methoxy]-2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene-7-carbonitrile (PubChem CID 69458479) has the molecular formula C23H18N4O4S and a molecular weight of 446.49 g/mol. Its IUPAC name is 7-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methoxy]-2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene-7-carbonitrile.
| Compound Name | 7-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methoxy]-2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene-7-carbonitrile |
|---|---|
| PubChem CID | 69458479 |
| Molecular Formula | C23H18N4O4S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 7-(1,3-benzothiazol-2-yl)-3-[(3,4,5-trimethoxyphenyl)methoxy]-2,4-diazabicyclo[4.1.0]hepta-1,3,5-triene-7-carbonitrile |
| SMILES | COc1cc(COc2ncc3c(n2)C3(C#N)c2nc3ccccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C23H18N4O4S/c1-28-16-8-13(9-17(29-2)19(16)30-3)11-31-22-25-10-14-20(27-22)23(14,12-24)21-26-15-6-4-5-7-18(15)32-21/h4-10H,11H2,1-3H3 |
| InChIKey | ZLGJHRLBJLLESR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |