About benzotriazol-4-imine
benzotriazol-4-imine (PubChem CID 69458728) has the molecular formula C6H4N4
and a molecular weight of 132.13 g/mol. Its IUPAC name is benzotriazol-4-imine.
Molecular Properties
| Compound Name | benzotriazol-4-imine |
| PubChem CID | 69458728 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | benzotriazol-4-imine |
| SMILES | [H]/N=C1\C=CC=C2N=NN=C21 |
| InChI | InChI=1S/C6H4N4/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3,7H/b7-4+ |
| InChIKey | VBTNOLKWCWLKCA-QPJJXVBHSA-N |
| XLogP | 1.28 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze benzotriazol-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-4-imine?
The IUPAC name of benzotriazol-4-imine (CID 69458728) is benzotriazol-4-imine.
What is the SMILES notation for benzotriazol-4-imine?
The canonical SMILES for benzotriazol-4-imine is [H]/N=C1\C=CC=C2N=NN=C21.
What is the InChIKey of benzotriazol-4-imine?
The InChIKey is VBTNOLKWCWLKCA-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H4N4/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3,7H/b7-4+.
What are the key properties of benzotriazol-4-imine?
benzotriazol-4-imine has a molecular weight of 132.13 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-4-imine is sourced from PubChem (CID 69458728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).