About 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one
3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (PubChem CID 69459044) has the molecular formula C25H24N2O3
and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 69459044 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| SMILES | COc1cc2c(cc1OC)N(C)C(=O)C(Cc1ccccc1)N=C2c1ccccc1 |
| InChI | InChI=1S/C25H24N2O3/c1-27-21-16-23(30-3)22(29-2)15-19(21)24(18-12-8-5-9-13-18)26-20(25(27)28)14-17-10-6-4-7-11-17/h4-13,15-16,20H,14H2,1-3H3 |
| InChIKey | DFWFNMPYVHZTMB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one (CID 69459044) is 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one is COc1cc2c(cc1OC)N(C)C(=O)C(Cc1ccccc1)N=C2c1ccccc1.
What is the InChIKey of 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
The InChIKey is DFWFNMPYVHZTMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O3/c1-27-21-16-23(30-3)22(29-2)15-19(21)24(18-12-8-5-9-13-18)26-20(25(27)28)14-17-10-6-4-7-11-17/h4-13,15-16,20H,14H2,1-3H3.
What are the key properties of 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one?
3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one has a molecular weight of 400.48 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7,8-dimethoxy-1-methyl-5-phenyl-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 69459044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).