About 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine
1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine (PubChem CID 69459147) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine.
Molecular Properties
| Compound Name | 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine |
| PubChem CID | 69459147 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine |
| SMILES | CCOn1c(C)c(C)n2cnc(N)c12 |
| InChI | InChI=1S/C9H14N4O/c1-4-14-13-7(3)6(2)12-5-11-8(10)9(12)13/h5H,4,10H2,1-3H3 |
| InChIKey | MCWQIDVSDAQJMP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine?
The IUPAC name of 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine (CID 69459147) is 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine.
What is the SMILES notation for 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine?
The canonical SMILES for 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine is CCOn1c(C)c(C)n2cnc(N)c12.
What is the InChIKey of 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine?
The InChIKey is MCWQIDVSDAQJMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O/c1-4-14-13-7(3)6(2)12-5-11-8(10)9(12)13/h5H,4,10H2,1-3H3.
What are the key properties of 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine?
1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine has a molecular weight of 194.24 g/mol, XLogP of 0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2,3-dimethylimidazo[1,5-a]imidazol-7-amine is sourced from PubChem (CID 69459147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).