About 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol
3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 694593) has the molecular formula C15H10F2N2OS
and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol.
Molecular Properties
| Compound Name | 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol |
| PubChem CID | 694593 |
| Molecular Formula | C15H10F2N2OS |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | Oc1cccc(Nc2nc(-c3ccc(F)cc3F)cs2)c1 |
| InChI | InChI=1S/C15H10F2N2OS/c16-9-4-5-12(13(17)6-9)14-8-21-15(19-14)18-10-2-1-3-11(20)7-10/h1-8,20H,(H,18,19) |
| InChIKey | HSAIDXNOFNJTBF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol?
The IUPAC name of 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol (CID 694593) is 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol.
What is the SMILES notation for 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol?
The canonical SMILES for 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol is Oc1cccc(Nc2nc(-c3ccc(F)cc3F)cs2)c1.
What is the InChIKey of 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol?
The InChIKey is HSAIDXNOFNJTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N2OS/c16-9-4-5-12(13(17)6-9)14-8-21-15(19-14)18-10-2-1-3-11(20)7-10/h1-8,20H,(H,18,19).
What are the key properties of 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol?
3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol has a molecular weight of 304.32 g/mol, XLogP of 4.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]amino]phenol is sourced from PubChem (CID 694593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).