About 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine
1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 69459501) has the molecular formula C5H9N3O3S
and a molecular weight of 191.21 g/mol. Its IUPAC name is 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine |
| PubChem CID | 69459501 |
| Molecular Formula | C5H9N3O3S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | CC(N)c1noc(S(C)(=O)=O)n1 |
| InChI | InChI=1S/C5H9N3O3S/c1-3(6)4-7-5(11-8-4)12(2,9)10/h3H,6H2,1-2H3 |
| InChIKey | OSOZFBHLGCIYBC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine?
The IUPAC name of 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine (CID 69459501) is 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine.
What is the SMILES notation for 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine?
The canonical SMILES for 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine is CC(N)c1noc(S(C)(=O)=O)n1.
What is the InChIKey of 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine?
The InChIKey is OSOZFBHLGCIYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O3S/c1-3(6)4-7-5(11-8-4)12(2,9)10/h3H,6H2,1-2H3.
What are the key properties of 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine?
1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine has a molecular weight of 191.21 g/mol, XLogP of -0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methylsulfonyl-1,2,4-oxadiazol-3-yl)ethanamine is sourced from PubChem (CID 69459501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).