C15H14ClNO3 — CID 69459643
ethyl 3-[(5-chloro-2-hydroxyphenyl)methyl]pyridine-2-carboxylate (PubChem CID 69459643) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is ethyl 3-[(5-chloro-2-hydroxyphenyl)methyl]pyridine-2-carboxylate.
| Compound Name | ethyl 3-[(5-chloro-2-hydroxyphenyl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 69459643 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | ethyl 3-[(5-chloro-2-hydroxyphenyl)methyl]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ncccc1Cc1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H14ClNO3/c1-2-20-15(19)14-10(4-3-7-17-14)8-11-9-12(16)5-6-13(11)18/h3-7,9,18H,2,8H2,1H3 |
| InChIKey | NZPRYHUPUVMHTD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |