About 3a,4-dihydro-1,3-benzodioxol-4-ol
3a,4-dihydro-1,3-benzodioxol-4-ol (PubChem CID 69459644) has the molecular formula C7H8O3
and a molecular weight of 140.14 g/mol. Its IUPAC name is 3a,4-dihydro-1,3-benzodioxol-4-ol.
Molecular Properties
| Compound Name | 3a,4-dihydro-1,3-benzodioxol-4-ol |
| PubChem CID | 69459644 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | 3a,4-dihydro-1,3-benzodioxol-4-ol |
| SMILES | OC1C=CC=C2OCOC21 |
| InChI | InChI=1S/C7H8O3/c8-5-2-1-3-6-7(5)10-4-9-6/h1-3,5,7-8H,4H2 |
| InChIKey | RGJGECMNFXZHPS-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3a,4-dihydro-1,3-benzodioxol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4-dihydro-1,3-benzodioxol-4-ol?
The IUPAC name of 3a,4-dihydro-1,3-benzodioxol-4-ol (CID 69459644) is 3a,4-dihydro-1,3-benzodioxol-4-ol.
What is the SMILES notation for 3a,4-dihydro-1,3-benzodioxol-4-ol?
The canonical SMILES for 3a,4-dihydro-1,3-benzodioxol-4-ol is OC1C=CC=C2OCOC21.
What is the InChIKey of 3a,4-dihydro-1,3-benzodioxol-4-ol?
The InChIKey is RGJGECMNFXZHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3/c8-5-2-1-3-6-7(5)10-4-9-6/h1-3,5,7-8H,4H2.
What are the key properties of 3a,4-dihydro-1,3-benzodioxol-4-ol?
3a,4-dihydro-1,3-benzodioxol-4-ol has a molecular weight of 140.14 g/mol, XLogP of 0.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4-dihydro-1,3-benzodioxol-4-ol is sourced from PubChem (CID 69459644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).