About methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate
methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate (PubChem CID 694598) has the molecular formula C16H16N2O4S
and a molecular weight of 332.38 g/mol. Its IUPAC name is methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate.
Molecular Properties
| Compound Name | methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate |
| PubChem CID | 694598 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(C(=O)CSc2nc(C)cc(C)n2)ccc1O |
| InChI | InChI=1S/C16H16N2O4S/c1-9-6-10(2)18-16(17-9)23-8-14(20)11-4-5-13(19)12(7-11)15(21)22-3/h4-7,19H,8H2,1-3H3 |
| InChIKey | OPXMZNSFIUHMNP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate?
The IUPAC name of methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate (CID 694598) is methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate.
What is the SMILES notation for methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate?
The canonical SMILES for methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate is COC(=O)c1cc(C(=O)CSc2nc(C)cc(C)n2)ccc1O.
What is the InChIKey of methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate?
The InChIKey is OPXMZNSFIUHMNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4S/c1-9-6-10(2)18-16(17-9)23-8-14(20)11-4-5-13(19)12(7-11)15(21)22-3/h4-7,19H,8H2,1-3H3.
What are the key properties of methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate?
methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate has a molecular weight of 332.38 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]-2-hydroxybenzoate is sourced from PubChem (CID 694598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).