C29H35ClF3N3O4 — CID 69459881
[3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indol-7-yl]-[(2R,6S)-2,6-dimethylpiperidin-1-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 69459881) has the molecular formula C29H35ClF3N3O4 and a molecular weight of 582.06 g/mol. Its IUPAC name is [3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indol-7-yl]-[(2R,6S)-2,6-dimethylpiperidin-1-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indol-7-yl]-[(2R,6S)-2,6-dimethylpiperidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69459881 |
| Molecular Formula | C29H35ClF3N3O4 |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | [3-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1H-indol-7-yl]-[(2R,6S)-2,6-dimethylpiperidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H](Cc1c[nH]c2c(C(=O)N3[C@H](C)CCC[C@@H]3C)cccc12)NC[C@H](O)c1cccc(Cl)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H34ClN3O2.C2HF3O2/c1-17(29-16-25(32)20-9-5-10-22(28)14-20)13-21-15-30-26-23(21)11-6-12-24(26)27(33)31-18(2)7-4-8-19(31)3;3-2(4,5)1(6)7/h5-6,9-12,14-15,17-19,25,29-30,32H,4,7-8,13,16H2,1-3H3;(H,6,7)/t17-,18-,19+,25+;/m1./s1 |
| InChIKey | ZEQUQSJURRNUST-SALSKJIPSA-N |
| XLogP | 6.11 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |