About imidazo[1,2-b]pyrazole-5,7-diamine
imidazo[1,2-b]pyrazole-5,7-diamine (PubChem CID 69459916) has the molecular formula C5H7N5
and a molecular weight of 137.15 g/mol. Its IUPAC name is imidazo[1,2-b]pyrazole-5,7-diamine.
Molecular Properties
| Compound Name | imidazo[1,2-b]pyrazole-5,7-diamine |
| PubChem CID | 69459916 |
| Molecular Formula | C5H7N5 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | imidazo[1,2-b]pyrazole-5,7-diamine |
| SMILES | Nc1cn(N)n2ccnc12 |
| InChI | InChI=1S/C5H7N5/c6-4-3-10(7)9-2-1-8-5(4)9/h1-3H,6-7H2 |
| InChIKey | VUUIBMNEUZLWHW-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazo[1,2-b]pyrazole-5,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-b]pyrazole-5,7-diamine?
The IUPAC name of imidazo[1,2-b]pyrazole-5,7-diamine (CID 69459916) is imidazo[1,2-b]pyrazole-5,7-diamine.
What is the SMILES notation for imidazo[1,2-b]pyrazole-5,7-diamine?
The canonical SMILES for imidazo[1,2-b]pyrazole-5,7-diamine is Nc1cn(N)n2ccnc12.
What is the InChIKey of imidazo[1,2-b]pyrazole-5,7-diamine?
The InChIKey is VUUIBMNEUZLWHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N5/c6-4-3-10(7)9-2-1-8-5(4)9/h1-3H,6-7H2.
What are the key properties of imidazo[1,2-b]pyrazole-5,7-diamine?
imidazo[1,2-b]pyrazole-5,7-diamine has a molecular weight of 137.15 g/mol, XLogP of -0.57, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-b]pyrazole-5,7-diamine is sourced from PubChem (CID 69459916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).