About 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol
2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol (PubChem CID 69459922) has the molecular formula C6H9N5O2
and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol.
Molecular Properties
| Compound Name | 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol |
| PubChem CID | 69459922 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol |
| SMILES | Nc1nnn2ccn(OCCO)c12 |
| InChI | InChI=1S/C6H9N5O2/c7-5-6-10(9-8-5)1-2-11(6)13-4-3-12/h1-2,12H,3-4,7H2 |
| InChIKey | LJHLBNNJGSAAQG-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol?
The IUPAC name of 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol (CID 69459922) is 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol.
What is the SMILES notation for 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol?
The canonical SMILES for 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol is Nc1nnn2ccn(OCCO)c12.
What is the InChIKey of 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol?
The InChIKey is LJHLBNNJGSAAQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5O2/c7-5-6-10(9-8-5)1-2-11(6)13-4-3-12/h1-2,12H,3-4,7H2.
What are the key properties of 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol?
2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol has a molecular weight of 183.17 g/mol, XLogP of -1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminoimidazo[1,2-c]triazol-4-yl)oxyethanol is sourced from PubChem (CID 69459922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).