About acetamide;5-amino-1H-pyrimidin-6-one
acetamide;5-amino-1H-pyrimidin-6-one (PubChem CID 69460116) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is acetamide;5-amino-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | acetamide;5-amino-1H-pyrimidin-6-one |
| PubChem CID | 69460116 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | acetamide;5-amino-1H-pyrimidin-6-one |
| SMILES | CC(N)=O.Nc1cnc[nH]c1=O |
| InChI | InChI=1S/C4H5N3O.C2H5NO/c5-3-1-6-2-7-4(3)8;1-2(3)4/h1-2H,5H2,(H,6,7,8);1H3,(H2,3,4) |
| InChIKey | CTIUIIIAEFJRHQ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetamide;5-amino-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;5-amino-1H-pyrimidin-6-one?
The IUPAC name of acetamide;5-amino-1H-pyrimidin-6-one (CID 69460116) is acetamide;5-amino-1H-pyrimidin-6-one.
What is the SMILES notation for acetamide;5-amino-1H-pyrimidin-6-one?
The canonical SMILES for acetamide;5-amino-1H-pyrimidin-6-one is CC(N)=O.Nc1cnc[nH]c1=O.
What is the InChIKey of acetamide;5-amino-1H-pyrimidin-6-one?
The InChIKey is CTIUIIIAEFJRHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O.C2H5NO/c5-3-1-6-2-7-4(3)8;1-2(3)4/h1-2H,5H2,(H,6,7,8);1H3,(H2,3,4).
What are the key properties of acetamide;5-amino-1H-pyrimidin-6-one?
acetamide;5-amino-1H-pyrimidin-6-one has a molecular weight of 170.17 g/mol, XLogP of -1.16, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;5-amino-1H-pyrimidin-6-one is sourced from PubChem (CID 69460116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).