About 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride
2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride (PubChem CID 69460572) has the molecular formula C31H46ClNO3
and a molecular weight of 516.17 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride |
| PubChem CID | 69460572 |
| Molecular Formula | C31H46ClNO3 |
| Molecular Weight | 516.17 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1.Cl.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H35NO2.C12H10O.ClH/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h17H,3-16H2,1-2H3;1-10H;1H |
| InChIKey | KHUMOXRGHDRZED-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.17 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride (CID 69460572) is 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride is CCN(CC)CCOC(=O)C1(C2CCCCC2)CCCCC1.Cl.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride?
The InChIKey is KHUMOXRGHDRZED-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO2.C12H10O.ClH/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h17H,3-16H2,1-2H3;1-10H;1H.
What are the key properties of 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride?
2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride has a molecular weight of 516.17 g/mol, XLogP of 8.30, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 1-cyclohexylcyclohexane-1-carboxylate;phenoxybenzene;hydrochloride is sourced from PubChem (CID 69460572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).