About 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one
4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one (PubChem CID 69460628) has the molecular formula C16H10N4O
and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one.
Molecular Properties
| Compound Name | 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one |
| PubChem CID | 69460628 |
| Molecular Formula | C16H10N4O |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one |
| SMILES | Nc1cc2c(c3c1=NC(c1ccccc1)=N3)C(=O)N=CC=2 |
| InChI | InChI=1S/C16H10N4O/c17-11-8-10-6-7-18-16(21)12(10)14-13(11)19-15(20-14)9-4-2-1-3-5-9/h1-8H,17H2 |
| InChIKey | HRIFACSIHFTPNO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one?
The IUPAC name of 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one (CID 69460628) is 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one.
What is the SMILES notation for 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one?
The canonical SMILES for 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one is Nc1cc2c(c3c1=NC(c1ccccc1)=N3)C(=O)N=CC=2.
What is the InChIKey of 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one?
The InChIKey is HRIFACSIHFTPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N4O/c17-11-8-10-6-7-18-16(21)12(10)14-13(11)19-15(20-14)9-4-2-1-3-5-9/h1-8H,17H2.
What are the key properties of 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one?
4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one has a molecular weight of 274.28 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-phenylimidazo[4,5-h]isoquinolin-9-one is sourced from PubChem (CID 69460628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).