C14H8FN2O3- — CID 6946088
1-(4-fluorophenyl)-3-(furan-2-yl)pyrazole-5-carboxylate (PubChem CID 6946088) has the molecular formula C14H8FN2O3- and a molecular weight of 271.23 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(furan-2-yl)pyrazole-5-carboxylate.
| Compound Name | 1-(4-fluorophenyl)-3-(furan-2-yl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 6946088 |
| Molecular Formula | C14H8FN2O3- |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(furan-2-yl)pyrazole-5-carboxylate |
| SMILES | O=C([O-])c1cc(-c2ccco2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H9FN2O3/c15-9-3-5-10(6-4-9)17-12(14(18)19)8-11(16-17)13-2-1-7-20-13/h1-8H,(H,18,19)/p-1 |
| InChIKey | UVYYJFKYRZOUPJ-UHFFFAOYSA-M |
| XLogP | 1.63 |
| TPSA | 71.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |